C22H38S — CID 173468249
(2E,4E,7E)-4,9-diethyl-3,8,9,13-tetramethyltetradeca-2,4,7,12-tetraene-1-thiol (PubChem CID 173468249) has the molecular formula C22H38S and a molecular weight of 334.61 g/mol. Its IUPAC name is (2E,4E,7E)-4,9-diethyl-3,8,9,13-tetramethyltetradeca-2,4,7,12-tetraene-1-thiol.
| Compound Name | (2E,4E,7E)-4,9-diethyl-3,8,9,13-tetramethyltetradeca-2,4,7,12-tetraene-1-thiol |
|---|---|
| PubChem CID | 173468249 |
| Molecular Formula | C22H38S |
| Molecular Weight | 334.61 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | (2E,4E,7E)-4,9-diethyl-3,8,9,13-tetramethyltetradeca-2,4,7,12-tetraene-1-thiol |
| SMILES | CCC(=C\C/C=C(\C)C(C)(CC)CCC=C(C)C)/C(C)=C/CS |
| InChI | InChI=1S/C22H38S/c1-8-21(19(5)15-17-23)14-10-13-20(6)22(7,9-2)16-11-12-18(3)4/h12-15,23H,8-11,16-17H2,1-7H3/b19-15+,20-13+,21-14+ |
| InChIKey | BAEMKAATKUUZOP-YIYGKJNXSA-N |
| XLogP | 7.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.61 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|