C16H19N — CID 123873947
4-[(3-propan-2-ylphenyl)methyl]aniline (PubChem CID 123873947) has the molecular formula C16H19N and a molecular weight of 225.34 g/mol. Its IUPAC name is 4-[(3-propan-2-ylphenyl)methyl]aniline.
| Compound Name | 4-[(3-propan-2-ylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 123873947 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 4-[(3-propan-2-ylphenyl)methyl]aniline |
| SMILES | CC(C)c1cccc(Cc2ccc(N)cc2)c1 |
| InChI | InChI=1S/C16H19N/c1-12(2)15-5-3-4-14(11-15)10-13-6-8-16(17)9-7-13/h3-9,11-12H,10,17H2,1-2H3 |
| InChIKey | ZHMTVZMKFBVNIP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|