C34H33NO2 — CID 123873968
2-[[3-methyl-4-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]methylidene]butanoic acid (PubChem CID 123873968) has the molecular formula C34H33NO2 and a molecular weight of 487.64 g/mol. Its IUPAC name is 2-[[3-methyl-4-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]methylidene]butanoic acid.
| Compound Name | 2-[[3-methyl-4-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 123873968 |
| Molecular Formula | C34H33NO2 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 2-[[3-methyl-4-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]methylidene]butanoic acid |
| SMILES | CCC(=Cc1ccc(C=Cc2ccc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc2)c(C)c1)C(=O)O |
| InChI | InChI=1S/C34H33NO2/c1-5-29(34(36)37)23-28-11-15-30(26(4)22-28)14-10-27-12-20-33(21-13-27)35(31-16-6-24(2)7-17-31)32-18-8-25(3)9-19-32/h6-23H,5H2,1-4H3,(H,36,37) |
| InChIKey | SJBRVDXSBAKQBN-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|