C23H23ClF4 — CID 123874382
1-chloro-4-[1,2-difluoro-2-[2-fluoro-4-(4-propylcyclohexyl)phenyl]ethenyl]-2-fluorobenzene (PubChem CID 123874382) has the molecular formula C23H23ClF4 and a molecular weight of 410.88 g/mol. Its IUPAC name is 1-chloro-4-[1,2-difluoro-2-[2-fluoro-4-(4-propylcyclohexyl)phenyl]ethenyl]-2-fluorobenzene.
| Compound Name | 1-chloro-4-[1,2-difluoro-2-[2-fluoro-4-(4-propylcyclohexyl)phenyl]ethenyl]-2-fluorobenzene |
|---|---|
| PubChem CID | 123874382 |
| Molecular Formula | C23H23ClF4 |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 1-chloro-4-[1,2-difluoro-2-[2-fluoro-4-(4-propylcyclohexyl)phenyl]ethenyl]-2-fluorobenzene |
| SMILES | CCCC1CCC(c2ccc(C(F)=C(F)c3ccc(Cl)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C23H23ClF4/c1-2-3-14-4-6-15(7-5-14)16-8-10-18(20(25)12-16)23(28)22(27)17-9-11-19(24)21(26)13-17/h8-15H,2-7H2,1H3 |
| InChIKey | UWJRYRPCBDYAQG-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|