C23H22F6 — CID 89147445
5-[(Z)-1,2-difluoro-2-[2-fluoro-4-(4-propylcyclohexyl)phenyl]ethenyl]-1,2,3-trifluorobenzene (PubChem CID 89147445) has the molecular formula C23H22F6 and a molecular weight of 412.42 g/mol. Its IUPAC name is 5-[(Z)-1,2-difluoro-2-[2-fluoro-4-(4-propylcyclohexyl)phenyl]ethenyl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[(Z)-1,2-difluoro-2-[2-fluoro-4-(4-propylcyclohexyl)phenyl]ethenyl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 89147445 |
| Molecular Formula | C23H22F6 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 5-[(Z)-1,2-difluoro-2-[2-fluoro-4-(4-propylcyclohexyl)phenyl]ethenyl]-1,2,3-trifluorobenzene |
| SMILES | CCCC1CCC(c2ccc(/C(F)=C(/F)c3cc(F)c(F)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C23H22F6/c1-2-3-13-4-6-14(7-5-13)15-8-9-17(18(24)10-15)22(28)21(27)16-11-19(25)23(29)20(26)12-16/h8-14H,2-7H2,1H3/b22-21- |
| InChIKey | UNXOAWQQIVWMCI-DQRAZIAOSA-N |
| XLogP | 8.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|