C29H38F4 — CID 130462328
2-fluoro-4-[4-(4-propylcyclohexyl)cyclohexyl]-1-[(3E,5E,7Z)-6,7,8-trifluoroocta-3,5,7-trien-4-yl]benzene (PubChem CID 130462328) has the molecular formula C29H38F4 and a molecular weight of 462.62 g/mol. Its IUPAC name is 2-fluoro-4-[4-(4-propylcyclohexyl)cyclohexyl]-1-[(3E,5E,7Z)-6,7,8-trifluoroocta-3,5,7-trien-4-yl]benzene.
| Compound Name | 2-fluoro-4-[4-(4-propylcyclohexyl)cyclohexyl]-1-[(3E,5E,7Z)-6,7,8-trifluoroocta-3,5,7-trien-4-yl]benzene |
|---|---|
| PubChem CID | 130462328 |
| Molecular Formula | C29H38F4 |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | 2-fluoro-4-[4-(4-propylcyclohexyl)cyclohexyl]-1-[(3E,5E,7Z)-6,7,8-trifluoroocta-3,5,7-trien-4-yl]benzene |
| SMILES | CC/C=C(\C=C(F)/C(F)=C/F)c1ccc(C2CCC(C3CCC(CCC)CC3)CC2)cc1F |
| InChI | InChI=1S/C29H38F4/c1-3-5-20-7-9-21(10-8-20)22-11-13-23(14-12-22)24-15-16-26(27(31)17-24)25(6-4-2)18-28(32)29(33)19-30/h6,15-23H,3-5,7-14H2,1-2H3/b25-6+,28-18+,29-19- |
| InChIKey | BUDGPVCLAOIEFZ-HKCMDVLUSA-N |
| XLogP | 10.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|