C17H30N4 — CID 123876460
2-[4-(2,4,4-trimethylhexan-2-yl)piperazin-1-yl]pyrimidine (PubChem CID 123876460) has the molecular formula C17H30N4 and a molecular weight of 290.45 g/mol. Its IUPAC name is 2-[4-(2,4,4-trimethylhexan-2-yl)piperazin-1-yl]pyrimidine.
| Compound Name | 2-[4-(2,4,4-trimethylhexan-2-yl)piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 123876460 |
| Molecular Formula | C17H30N4 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | 2-[4-(2,4,4-trimethylhexan-2-yl)piperazin-1-yl]pyrimidine |
| SMILES | CCC(C)(C)CC(C)(C)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H30N4/c1-6-16(2,3)14-17(4,5)21-12-10-20(11-13-21)15-18-8-7-9-19-15/h7-9H,6,10-14H2,1-5H3 |
| InChIKey | DJPICJPGRQAGTQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |