C21H36N2O2 — CID 123877999
(5R,8S,9S,10R,13S,14S)-3-(2-aminoethoxyimino)-10,13-dimethyl-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-5-ol (PubChem CID 123877999) has the molecular formula C21H36N2O2 and a molecular weight of 348.53 g/mol. Its IUPAC name is (5R,8S,9S,10R,13S,14S)-3-(2-aminoethoxyimino)-10,13-dimethyl-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-5-ol.
| Compound Name | (5R,8S,9S,10R,13S,14S)-3-(2-aminoethoxyimino)-10,13-dimethyl-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-5-ol |
|---|---|
| PubChem CID | 123877999 |
| Molecular Formula | C21H36N2O2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | (5R,8S,9S,10R,13S,14S)-3-(2-aminoethoxyimino)-10,13-dimethyl-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-5-ol |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CC[C@@]3(O)CC(=NOCCN)CC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C21H36N2O2/c1-19-8-3-4-17(19)16-6-11-21(24)14-15(23-25-13-12-22)5-10-20(21,2)18(16)7-9-19/h16-18,24H,3-14,22H2,1-2H3/t16-,17-,18-,19-,20+,21+/m0/s1 |
| InChIKey | OBAQZRVJIMCBOV-HQZQWKOLSA-N |
| XLogP | 3.87 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|