C24H42N2O2 — CID 87709669
(5S,6S,8S,9S,10R,13S,14S)-6,10,13-trimethyl-3-[3-(methylamino)propoxyimino]-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-5-ol (PubChem CID 87709669) has the molecular formula C24H42N2O2 and a molecular weight of 390.61 g/mol. Its IUPAC name is (5S,6S,8S,9S,10R,13S,14S)-6,10,13-trimethyl-3-[3-(methylamino)propoxyimino]-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-5-ol.
| Compound Name | (5S,6S,8S,9S,10R,13S,14S)-6,10,13-trimethyl-3-[3-(methylamino)propoxyimino]-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-5-ol |
|---|---|
| PubChem CID | 87709669 |
| Molecular Formula | C24H42N2O2 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.32 |
| IUPAC Name | (5S,6S,8S,9S,10R,13S,14S)-6,10,13-trimethyl-3-[3-(methylamino)propoxyimino]-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-5-ol |
| SMILES | CNCCCON=C1CC[C@]2(C)[C@H]3CC[C@]4(C)CCC[C@H]4[C@@H]3C[C@H](C)[C@@]2(O)C1 |
| InChI | InChI=1S/C24H42N2O2/c1-17-15-19-20-7-5-10-22(20,2)11-9-21(19)23(3)12-8-18(16-24(17,23)27)26-28-14-6-13-25-4/h17,19-21,25,27H,5-16H2,1-4H3/t17-,19-,20-,21-,22-,23+,24-/m0/s1 |
| InChIKey | IEJNSQKLWDUIQN-PQURANIKSA-N |
| XLogP | 4.76 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|