C9H10Br2O2S — CID 123878797
2,4-dibromo-1-propylsulfonylbenzene (PubChem CID 123878797) has the molecular formula C9H10Br2O2S and a molecular weight of 342.05 g/mol. Its IUPAC name is 2,4-dibromo-1-propylsulfonylbenzene.
| Compound Name | 2,4-dibromo-1-propylsulfonylbenzene |
|---|---|
| PubChem CID | 123878797 |
| Molecular Formula | C9H10Br2O2S |
| Molecular Weight | 342.05 g/mol |
| Exact Mass | 339.88 |
| IUPAC Name | 2,4-dibromo-1-propylsulfonylbenzene |
| SMILES | CCCS(=O)(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C9H10Br2O2S/c1-2-5-14(12,13)9-4-3-7(10)6-8(9)11/h3-4,6H,2,5H2,1H3 |
| InChIKey | OJGNPUNYPPFNFV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.05 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |