About 4-cyclohexylbutyl 4-tert-butyl-3-imino-5-oxoheptanoate
4-cyclohexylbutyl 4-tert-butyl-3-imino-5-oxoheptanoate (PubChem CID 123880490) has the molecular formula C21H37NO3
and a molecular weight of 351.53 g/mol. Its IUPAC name is 4-cyclohexylbutyl 4-tert-butyl-3-imino-5-oxoheptanoate.
Molecular Properties
| Compound Name | 4-cyclohexylbutyl 4-tert-butyl-3-imino-5-oxoheptanoate |
| PubChem CID | 123880490 |
| Molecular Formula | C21H37NO3 |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.28 |
| IUPAC Name | 4-cyclohexylbutyl 4-tert-butyl-3-imino-5-oxoheptanoate |
| SMILES | [H]/N=C(/CC(=O)OCCCCC1CCCCC1)C(C(=O)CC)C(C)(C)C |
| InChI | InChI=1S/C21H37NO3/c1-5-18(23)20(21(2,3)4)17(22)15-19(24)25-14-10-9-13-16-11-7-6-8-12-16/h16,20,22H,5-15H2,1-4H3/b22-17- |
| InChIKey | MOMPZRTUKSIEKM-XLNRJJMWSA-N |
| XLogP | 5.33 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexylbutyl 4-tert-butyl-3-imino-5-oxoheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylbutyl 4-tert-butyl-3-imino-5-oxoheptanoate?
The IUPAC name of 4-cyclohexylbutyl 4-tert-butyl-3-imino-5-oxoheptanoate (CID 123880490) is 4-cyclohexylbutyl 4-tert-butyl-3-imino-5-oxoheptanoate.
What is the SMILES notation for 4-cyclohexylbutyl 4-tert-butyl-3-imino-5-oxoheptanoate?
The canonical SMILES for 4-cyclohexylbutyl 4-tert-butyl-3-imino-5-oxoheptanoate is [H]/N=C(/CC(=O)OCCCCC1CCCCC1)C(C(=O)CC)C(C)(C)C.
What is the InChIKey of 4-cyclohexylbutyl 4-tert-butyl-3-imino-5-oxoheptanoate?
The InChIKey is MOMPZRTUKSIEKM-XLNRJJMWSA-N. The full InChI is InChI=1S/C21H37NO3/c1-5-18(23)20(21(2,3)4)17(22)15-19(24)25-14-10-9-13-16-11-7-6-8-12-16/h16,20,22H,5-15H2,1-4H3/b22-17-.
What are the key properties of 4-cyclohexylbutyl 4-tert-butyl-3-imino-5-oxoheptanoate?
4-cyclohexylbutyl 4-tert-butyl-3-imino-5-oxoheptanoate has a molecular weight of 351.53 g/mol, XLogP of 5.33, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylbutyl 4-tert-butyl-3-imino-5-oxoheptanoate is sourced from PubChem (CID 123880490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).