C20H34O3 — CID 123882312
8-(1,4-dioxaspiro[4.5]decan-8-yl)-2,2-dimethyldec-9-en-5-one (PubChem CID 123882312) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is 8-(1,4-dioxaspiro[4.5]decan-8-yl)-2,2-dimethyldec-9-en-5-one.
| Compound Name | 8-(1,4-dioxaspiro[4.5]decan-8-yl)-2,2-dimethyldec-9-en-5-one |
|---|---|
| PubChem CID | 123882312 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 8-(1,4-dioxaspiro[4.5]decan-8-yl)-2,2-dimethyldec-9-en-5-one |
| SMILES | C=CC(CCC(=O)CCC(C)(C)C)C1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C20H34O3/c1-5-16(6-7-18(21)10-11-19(2,3)4)17-8-12-20(13-9-17)22-14-15-23-20/h5,16-17H,1,6-15H2,2-4H3 |
| InChIKey | RUZNDNJUUWOUGG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|