C13H21F2NO2 — CID 123882470
methyl 4-(1,1-difluoroethyl)-2-(hydroxymethyl)-N,5-dimethylhepta-2,4-dienimidate (PubChem CID 123882470) has the molecular formula C13H21F2NO2 and a molecular weight of 261.31 g/mol. Its IUPAC name is methyl 4-(1,1-difluoroethyl)-2-(hydroxymethyl)-N,5-dimethylhepta-2,4-dienimidate.
| Compound Name | methyl 4-(1,1-difluoroethyl)-2-(hydroxymethyl)-N,5-dimethylhepta-2,4-dienimidate |
|---|---|
| PubChem CID | 123882470 |
| Molecular Formula | C13H21F2NO2 |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | methyl 4-(1,1-difluoroethyl)-2-(hydroxymethyl)-N,5-dimethylhepta-2,4-dienimidate |
| SMILES | CCC(C)=C(C=C(CO)/C(=N/C)OC)C(C)(F)F |
| InChI | InChI=1S/C13H21F2NO2/c1-6-9(2)11(13(3,14)15)7-10(8-17)12(16-4)18-5/h7,17H,6,8H2,1-5H3/b10-7?,11-9?,16-12- |
| InChIKey | DPSHZQMIRZLBOW-ISMADJSUSA-N |
| XLogP | 2.96 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|