C22H39F4N2OP — CID 174004265
methyl (E)-N-[(Z)-1-[(5-fluoro-3-methyl-5-phosphanyl-2-propylheptyl)amino]-2-methylbut-1-enyl]-2-(trifluoromethyl)but-2-enimidate (PubChem CID 174004265) has the molecular formula C22H39F4N2OP and a molecular weight of 454.53 g/mol. Its IUPAC name is methyl (E)-N-[(Z)-1-[(5-fluoro-3-methyl-5-phosphanyl-2-propylheptyl)amino]-2-methylbut-1-enyl]-2-(trifluoromethyl)but-2-enimidate.
| Compound Name | methyl (E)-N-[(Z)-1-[(5-fluoro-3-methyl-5-phosphanyl-2-propylheptyl)amino]-2-methylbut-1-enyl]-2-(trifluoromethyl)but-2-enimidate |
|---|---|
| PubChem CID | 174004265 |
| Molecular Formula | C22H39F4N2OP |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | methyl (E)-N-[(Z)-1-[(5-fluoro-3-methyl-5-phosphanyl-2-propylheptyl)amino]-2-methylbut-1-enyl]-2-(trifluoromethyl)but-2-enimidate |
| SMILES | C/C=C(\C(=N/C(NCC(CCC)C(C)CC(F)(P)CC)=C(/C)CC)OC)C(F)(F)F |
| InChI | InChI=1S/C22H39F4N2OP/c1-8-12-17(16(6)13-21(23,30)11-4)14-27-19(15(5)9-2)28-20(29-7)18(10-3)22(24,25)26/h10,16-17,27H,8-9,11-14,30H2,1-7H3/b18-10+,19-15-,28-20? |
| InChIKey | NRMBXPBHJRTFGM-APHJJKBISA-N |
| XLogP | 7.16 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|