C12H13F3N2O — CID 123883586
(2R)-2-phenyl-2-[[(2S)-1,1,1-trifluoro-2-isocyanopropan-2-yl]amino]ethanol (PubChem CID 123883586) has the molecular formula C12H13F3N2O and a molecular weight of 258.24 g/mol. Its IUPAC name is (2R)-2-phenyl-2-[[(2S)-1,1,1-trifluoro-2-isocyanopropan-2-yl]amino]ethanol.
| Compound Name | (2R)-2-phenyl-2-[[(2S)-1,1,1-trifluoro-2-isocyanopropan-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 123883586 |
| Molecular Formula | C12H13F3N2O |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | (2R)-2-phenyl-2-[[(2S)-1,1,1-trifluoro-2-isocyanopropan-2-yl]amino]ethanol |
| SMILES | [C-]#[N+][C@](C)(N[C@@H](CO)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H13F3N2O/c1-11(16-2,12(13,14)15)17-10(8-18)9-6-4-3-5-7-9/h3-7,10,17-18H,8H2,1H3/t10-,11+/m0/s1 |
| InChIKey | PNEKROXEJHGSPC-WDEREUQCSA-N |
| XLogP | 2.51 |
| TPSA | 36.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|