C9H19NO2 — CID 123884100
(3,5-dimethoxycyclohexyl)methanamine (PubChem CID 123884100) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is (3,5-dimethoxycyclohexyl)methanamine.
| Compound Name | (3,5-dimethoxycyclohexyl)methanamine |
|---|---|
| PubChem CID | 123884100 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | (3,5-dimethoxycyclohexyl)methanamine |
| SMILES | COC1CC(CN)CC(OC)C1 |
| InChI | InChI=1S/C9H19NO2/c1-11-8-3-7(6-10)4-9(5-8)12-2/h7-9H,3-6,10H2,1-2H3 |
| InChIKey | CTRXZNAGBMERJH-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |