C8H17NO2 — CID 59234185
[(3S,5S)-5-methoxyoxepan-3-yl]methanamine (PubChem CID 59234185) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is [(3S,5S)-5-methoxyoxepan-3-yl]methanamine.
| Compound Name | [(3S,5S)-5-methoxyoxepan-3-yl]methanamine |
|---|---|
| PubChem CID | 59234185 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | [(3S,5S)-5-methoxyoxepan-3-yl]methanamine |
| SMILES | CO[C@@H]1CCOC[C@H](CN)C1 |
| InChI | InChI=1S/C8H17NO2/c1-10-8-2-3-11-6-7(4-8)5-9/h7-8H,2-6,9H2,1H3/t7-,8+/m0/s1 |
| InChIKey | WDYPFMANBHMEBD-JGVFFNPUSA-N |
| XLogP | 0.39 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |