C16H31NO3 — CID 143289321
N-[(3S,5R)-5-methoxyoxepan-3-yl]nonanamide (PubChem CID 143289321) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is N-[(3S,5R)-5-methoxyoxepan-3-yl]nonanamide.
| Compound Name | N-[(3S,5R)-5-methoxyoxepan-3-yl]nonanamide |
|---|---|
| PubChem CID | 143289321 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | N-[(3S,5R)-5-methoxyoxepan-3-yl]nonanamide |
| SMILES | CCCCCCCCC(=O)N[C@@H]1COCC[C@H](OC)C1 |
| InChI | InChI=1S/C16H31NO3/c1-3-4-5-6-7-8-9-16(18)17-14-12-15(19-2)10-11-20-13-14/h14-15H,3-13H2,1-2H3,(H,17,18)/t14-,15-/m0/s1 |
| InChIKey | LMIGBLOMBFENBG-GJZGRUSLSA-N |
| XLogP | 3.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|