C13H21NO — CID 123885167
1-(3-ethenyl-5,6-dimethyl-2-azabicyclo[3.1.0]hexan-2-yl)butan-1-one (PubChem CID 123885167) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 1-(3-ethenyl-5,6-dimethyl-2-azabicyclo[3.1.0]hexan-2-yl)butan-1-one.
| Compound Name | 1-(3-ethenyl-5,6-dimethyl-2-azabicyclo[3.1.0]hexan-2-yl)butan-1-one |
|---|---|
| PubChem CID | 123885167 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 1-(3-ethenyl-5,6-dimethyl-2-azabicyclo[3.1.0]hexan-2-yl)butan-1-one |
| SMILES | C=CC1CC2(C)C(C)C2N1C(=O)CCC |
| InChI | InChI=1S/C13H21NO/c1-5-7-11(15)14-10(6-2)8-13(4)9(3)12(13)14/h6,9-10,12H,2,5,7-8H2,1,3-4H3 |
| InChIKey | RBOWMWUIKGAVES-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|