C8H26N6Si — CID 123885486
2-[1,1-bis(2,2-dimethylhydrazinyl)-2-silylethyl]-1,1-dimethylhydrazine (PubChem CID 123885486) has the molecular formula C8H26N6Si and a molecular weight of 234.42 g/mol. Its IUPAC name is 2-[1,1-bis(2,2-dimethylhydrazinyl)-2-silylethyl]-1,1-dimethylhydrazine.
| Compound Name | 2-[1,1-bis(2,2-dimethylhydrazinyl)-2-silylethyl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 123885486 |
| Molecular Formula | C8H26N6Si |
| Molecular Weight | 234.42 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 2-[1,1-bis(2,2-dimethylhydrazinyl)-2-silylethyl]-1,1-dimethylhydrazine |
| SMILES | CN(C)NC(C[SiH3])(NN(C)C)NN(C)C |
| InChI | InChI=1S/C8H26N6Si/c1-12(2)9-8(7-15,10-13(3)4)11-14(5)6/h9-11H,7H2,1-6,15H3 |
| InChIKey | VTEKIAZMTZQDCT-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 45.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.42 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|