C13H26O4 — CID 123886318
2-propan-2-yloxyethyl 3-methoxy-2,2,3-trimethylbutanoate (PubChem CID 123886318) has the molecular formula C13H26O4 and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl 3-methoxy-2,2,3-trimethylbutanoate.
| Compound Name | 2-propan-2-yloxyethyl 3-methoxy-2,2,3-trimethylbutanoate |
|---|---|
| PubChem CID | 123886318 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 2-propan-2-yloxyethyl 3-methoxy-2,2,3-trimethylbutanoate |
| SMILES | COC(C)(C)C(C)(C)C(=O)OCCOC(C)C |
| InChI | InChI=1S/C13H26O4/c1-10(2)16-8-9-17-11(14)12(3,4)13(5,6)15-7/h10H,8-9H2,1-7H3 |
| InChIKey | CCFBEEGCMUHKDP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|