C20H40O4 — CID 135188610
2-propan-2-yloxyethyl 2-methyl-2-(2,2,4,4-tetramethylheptoxy)propanoate (PubChem CID 135188610) has the molecular formula C20H40O4 and a molecular weight of 344.54 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl 2-methyl-2-(2,2,4,4-tetramethylheptoxy)propanoate.
| Compound Name | 2-propan-2-yloxyethyl 2-methyl-2-(2,2,4,4-tetramethylheptoxy)propanoate |
|---|---|
| PubChem CID | 135188610 |
| Molecular Formula | C20H40O4 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.29 |
| IUPAC Name | 2-propan-2-yloxyethyl 2-methyl-2-(2,2,4,4-tetramethylheptoxy)propanoate |
| SMILES | CCCC(C)(C)CC(C)(C)COC(C)(C)C(=O)OCCOC(C)C |
| InChI | InChI=1S/C20H40O4/c1-10-11-18(4,5)14-19(6,7)15-24-20(8,9)17(21)23-13-12-22-16(2)3/h16H,10-15H2,1-9H3 |
| InChIKey | AKLVSYXJUWIRMM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|