C20H39N3O6 — CID 166909839
2-(diaminomethylideneamino)ethyl 2-methyl-2-[(2-methyl-2-pentoxypropanoyl)oxymethyl]-3-propan-2-yloxypropanoate (PubChem CID 166909839) has the molecular formula C20H39N3O6 and a molecular weight of 417.55 g/mol. Its IUPAC name is 2-(diaminomethylideneamino)ethyl 2-methyl-2-[(2-methyl-2-pentoxypropanoyl)oxymethyl]-3-propan-2-yloxypropanoate.
| Compound Name | 2-(diaminomethylideneamino)ethyl 2-methyl-2-[(2-methyl-2-pentoxypropanoyl)oxymethyl]-3-propan-2-yloxypropanoate |
|---|---|
| PubChem CID | 166909839 |
| Molecular Formula | C20H39N3O6 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.28 |
| IUPAC Name | 2-(diaminomethylideneamino)ethyl 2-methyl-2-[(2-methyl-2-pentoxypropanoyl)oxymethyl]-3-propan-2-yloxypropanoate |
| SMILES | CCCCCOC(C)(C)C(=O)OCC(C)(COC(C)C)C(=O)OCCN=C(N)N |
| InChI | InChI=1S/C20H39N3O6/c1-7-8-9-11-29-19(4,5)16(24)28-14-20(6,13-27-15(2)3)17(25)26-12-10-23-18(21)22/h15H,7-14H2,1-6H3,(H4,21,22,23) |
| InChIKey | JCQKRQMIWPIWNG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|