C23H18N2O3 — CID 123887335
4-(2-oxo-4,5-diphenyl-5,6-dihydro-1H-pyrimidin-6-yl)benzoic acid (PubChem CID 123887335) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 4-(2-oxo-4,5-diphenyl-5,6-dihydro-1H-pyrimidin-6-yl)benzoic acid.
| Compound Name | 4-(2-oxo-4,5-diphenyl-5,6-dihydro-1H-pyrimidin-6-yl)benzoic acid |
|---|---|
| PubChem CID | 123887335 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 4-(2-oxo-4,5-diphenyl-5,6-dihydro-1H-pyrimidin-6-yl)benzoic acid |
| SMILES | O=C1N=C(c2ccccc2)C(c2ccccc2)C(c2ccc(C(=O)O)cc2)N1 |
| InChI | InChI=1S/C23H18N2O3/c26-22(27)18-13-11-17(12-14-18)21-19(15-7-3-1-4-8-15)20(24-23(28)25-21)16-9-5-2-6-10-16/h1-14,19,21H,(H,25,28)(H,26,27) |
| InChIKey | WZQFHCMLNSOKAM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |