C15H13BrN2 — CID 15808935
4-bromo-3,5-diphenyl-4,5-dihydro-1H-pyrazole (PubChem CID 15808935) has the molecular formula C15H13BrN2 and a molecular weight of 301.19 g/mol. Its IUPAC name is 4-bromo-3,5-diphenyl-4,5-dihydro-1H-pyrazole.
| Compound Name | 4-bromo-3,5-diphenyl-4,5-dihydro-1H-pyrazole |
|---|---|
| PubChem CID | 15808935 |
| Molecular Formula | C15H13BrN2 |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 4-bromo-3,5-diphenyl-4,5-dihydro-1H-pyrazole |
| SMILES | BrC1C(c2ccccc2)=NNC1c1ccccc1 |
| InChI | InChI=1S/C15H13BrN2/c16-13-14(11-7-3-1-4-8-11)17-18-15(13)12-9-5-2-6-10-12/h1-10,13-14,17H |
| InChIKey | YWWMFNMRTBIIKW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|