C16H15N3S — CID 71338907
3-methylsulfanyl-5,6-diphenyl-1,6-dihydro-1,2,4-triazine (PubChem CID 71338907) has the molecular formula C16H15N3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 3-methylsulfanyl-5,6-diphenyl-1,6-dihydro-1,2,4-triazine.
| Compound Name | 3-methylsulfanyl-5,6-diphenyl-1,6-dihydro-1,2,4-triazine |
|---|---|
| PubChem CID | 71338907 |
| Molecular Formula | C16H15N3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 3-methylsulfanyl-5,6-diphenyl-1,6-dihydro-1,2,4-triazine |
| SMILES | CSC1=NNC(c2ccccc2)C(c2ccccc2)=N1 |
| InChI | InChI=1S/C16H15N3S/c1-20-16-17-14(12-8-4-2-5-9-12)15(18-19-16)13-10-6-3-7-11-13/h2-11,15,18H,1H3 |
| InChIKey | XCSIIUJCQXCSCT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |