C15H15N5 — CID 1276082
[(5S)-5,6-diphenyl-2,5-dihydro-1,2,4-triazin-3-yl]hydrazine (PubChem CID 1276082) has the molecular formula C15H15N5 and a molecular weight of 265.32 g/mol. Its IUPAC name is [(5S)-5,6-diphenyl-2,5-dihydro-1,2,4-triazin-3-yl]hydrazine.
| Compound Name | [(5S)-5,6-diphenyl-2,5-dihydro-1,2,4-triazin-3-yl]hydrazine |
|---|---|
| PubChem CID | 1276082 |
| Molecular Formula | C15H15N5 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | [(5S)-5,6-diphenyl-2,5-dihydro-1,2,4-triazin-3-yl]hydrazine |
| SMILES | NNC1=N[C@@H](c2ccccc2)C(c2ccccc2)=NN1 |
| InChI | InChI=1S/C15H15N5/c16-18-15-17-13(11-7-3-1-4-8-11)14(19-20-15)12-9-5-2-6-10-12/h1-10,13H,16H2,(H2,17,18,20)/t13-/m0/s1 |
| InChIKey | VYAFEMVIZDFBCJ-ZDUSSCGKSA-N |
| XLogP | 1.55 |
| TPSA | 74.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|