C31H29N5S — CID 93475605
1-[(5R)-5,6-diphenyl-2,5-dihydro-1,2,4-triazin-3-yl]-2-[(E,3R)-3-(2-methylphenyl)sulfanyl-3-phenylprop-1-enyl]hydrazine (PubChem CID 93475605) has the molecular formula C31H29N5S and a molecular weight of 503.68 g/mol. Its IUPAC name is 1-[(5R)-5,6-diphenyl-2,5-dihydro-1,2,4-triazin-3-yl]-2-[(E,3R)-3-(2-methylphenyl)sulfanyl-3-phenylprop-1-enyl]hydrazine.
| Compound Name | 1-[(5R)-5,6-diphenyl-2,5-dihydro-1,2,4-triazin-3-yl]-2-[(E,3R)-3-(2-methylphenyl)sulfanyl-3-phenylprop-1-enyl]hydrazine |
|---|---|
| PubChem CID | 93475605 |
| Molecular Formula | C31H29N5S |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 1-[(5R)-5,6-diphenyl-2,5-dihydro-1,2,4-triazin-3-yl]-2-[(E,3R)-3-(2-methylphenyl)sulfanyl-3-phenylprop-1-enyl]hydrazine |
| SMILES | Cc1ccccc1S[C@H](/C=C/NNC1=N[C@H](c2ccccc2)C(c2ccccc2)=NN1)c1ccccc1 |
| InChI | InChI=1S/C31H29N5S/c1-23-13-11-12-20-27(23)37-28(24-14-5-2-6-15-24)21-22-32-35-31-33-29(25-16-7-3-8-17-25)30(34-36-31)26-18-9-4-10-19-26/h2-22,28-29,32H,1H3,(H2,33,35,36)/b22-21+/t28-,29-/m1/s1 |
| InChIKey | GUTPNHLGSTVLGX-PHJMZONKSA-N |
| XLogP | 6.54 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|