C18H19N3Se — CID 137301647
5,6-diphenyl-N-propan-2-yl-3,6-dihydro-1,3,4-selenadiazin-2-imine (PubChem CID 137301647) has the molecular formula C18H19N3Se and a molecular weight of 356.33 g/mol. Its IUPAC name is 5,6-diphenyl-N-propan-2-yl-3,6-dihydro-1,3,4-selenadiazin-2-imine.
| Compound Name | 5,6-diphenyl-N-propan-2-yl-3,6-dihydro-1,3,4-selenadiazin-2-imine |
|---|---|
| PubChem CID | 137301647 |
| Molecular Formula | C18H19N3Se |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 5,6-diphenyl-N-propan-2-yl-3,6-dihydro-1,3,4-selenadiazin-2-imine |
| SMILES | CC(C)/N=C1/NN=C(c2ccccc2)C(c2ccccc2)[Se]1 |
| InChI | InChI=1S/C18H19N3Se/c1-13(2)19-18-21-20-16(14-9-5-3-6-10-14)17(22-18)15-11-7-4-8-12-15/h3-13,17H,1-2H3,(H,19,21) |
| InChIKey | GNHKAUBUWNXCLL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|