C18H16N3O+ — CID 163698850
6-phenoxy-3-phenyl-1,3a,4,5-tetrahydropyrazolo[3,4-b]pyridin-7-ium (PubChem CID 163698850) has the molecular formula C18H16N3O+ and a molecular weight of 290.35 g/mol. Its IUPAC name is 6-phenoxy-3-phenyl-1,3a,4,5-tetrahydropyrazolo[3,4-b]pyridin-7-ium.
| Compound Name | 6-phenoxy-3-phenyl-1,3a,4,5-tetrahydropyrazolo[3,4-b]pyridin-7-ium |
|---|---|
| PubChem CID | 163698850 |
| Molecular Formula | C18H16N3O+ |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 6-phenoxy-3-phenyl-1,3a,4,5-tetrahydropyrazolo[3,4-b]pyridin-7-ium |
| SMILES | c1ccc(OC2=[N+]=C3NN=C(c4ccccc4)C3CC2)cc1 |
| InChI | InChI=1S/C18H15N3O/c1-3-7-13(8-4-1)17-15-11-12-16(19-18(15)21-20-17)22-14-9-5-2-6-10-14/h1-10,15H,11-12H2/p+1 |
| InChIKey | PMESUOVTPWUDOQ-UHFFFAOYSA-O |
| XLogP | 2.35 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|