C13H13Cl4N — CID 11438744
2,2,4,4-tetrachloro-3-phenyl-N-propan-2-ylcyclobutan-1-imine (PubChem CID 11438744) has the molecular formula C13H13Cl4N and a molecular weight of 325.07 g/mol. Its IUPAC name is 2,2,4,4-tetrachloro-3-phenyl-N-propan-2-ylcyclobutan-1-imine.
| Compound Name | 2,2,4,4-tetrachloro-3-phenyl-N-propan-2-ylcyclobutan-1-imine |
|---|---|
| PubChem CID | 11438744 |
| Molecular Formula | C13H13Cl4N |
| Molecular Weight | 325.07 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | 2,2,4,4-tetrachloro-3-phenyl-N-propan-2-ylcyclobutan-1-imine |
| SMILES | CC(C)N=C1C(Cl)(Cl)C(c2ccccc2)C1(Cl)Cl |
| InChI | InChI=1S/C13H13Cl4N/c1-8(2)18-11-12(14,15)10(13(11,16)17)9-6-4-3-5-7-9/h3-8,10H,1-2H3/b18-11- |
| InChIKey | ZIYDXGWKFGPLFG-WQRHYEAKSA-N |
| XLogP | 4.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.07 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|