C22H33NO3 — CID 11279854
3-phenyl-N-propan-2-yl-2,4,4-tri(propan-2-yloxy)cyclobut-2-en-1-imine (PubChem CID 11279854) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is 3-phenyl-N-propan-2-yl-2,4,4-tri(propan-2-yloxy)cyclobut-2-en-1-imine.
| Compound Name | 3-phenyl-N-propan-2-yl-2,4,4-tri(propan-2-yloxy)cyclobut-2-en-1-imine |
|---|---|
| PubChem CID | 11279854 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | 3-phenyl-N-propan-2-yl-2,4,4-tri(propan-2-yloxy)cyclobut-2-en-1-imine |
| SMILES | CC(C)/N=C1\C(OC(C)C)=C(c2ccccc2)C1(OC(C)C)OC(C)C |
| InChI | InChI=1S/C22H33NO3/c1-14(2)23-21-20(24-15(3)4)19(18-12-10-9-11-13-18)22(21,25-16(5)6)26-17(7)8/h9-17H,1-8H3/b23-21+ |
| InChIKey | LJNUOIYIMYGUAR-XTQSDGFTSA-N |
| XLogP | 5.23 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|