About CID 16687987
CID 16687987 (PubChem CID 16687987) has the molecular formula C13H19AlN2
and a molecular weight of 230.29 g/mol.
Molecular Properties
| Compound Name | CID 16687987 |
| PubChem CID | 16687987 |
| Molecular Formula | C13H19AlN2 |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | — |
| SMILES | CC(C)/N=c1\cccccc1N([Al])C(C)C |
| InChI | InChI=1S/C13H19N2.Al/c1-10(2)14-12-8-6-5-7-9-13(12)15-11(3)4;/h5-11H,1-4H3;/q-1;+1 |
| InChIKey | ACWXAXKFRSDRHI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 16687987 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 16687987?
The IUPAC name of CID 16687987 (CID 16687987) is not available.
What is the SMILES notation for CID 16687987?
The canonical SMILES for CID 16687987 is CC(C)/N=c1\cccccc1N([Al])C(C)C.
What is the InChIKey of CID 16687987?
The InChIKey is ACWXAXKFRSDRHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N2.Al/c1-10(2)14-12-8-6-5-7-9-13(12)15-11(3)4;/h5-11H,1-4H3;/q-1;+1.
What are the key properties of CID 16687987?
CID 16687987 has a molecular weight of 230.29 g/mol, XLogP of 2.29, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 16687987 is sourced from PubChem (CID 16687987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).