About CID 177191966
CID 177191966 (PubChem CID 177191966) has the molecular formula C9H13BNO2
and a molecular weight of 178.02 g/mol.
Molecular Properties
| Compound Name | CID 177191966 |
| PubChem CID | 177191966 |
| Molecular Formula | C9H13BNO2 |
| Molecular Weight | 178.02 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | — |
| SMILES | CC(C)N(O)c1ccccc1[B]O |
| InChI | InChI=1S/C9H13BNO2/c1-7(2)11(13)9-6-4-3-5-8(9)10-12/h3-7,12-13H,1-2H3 |
| InChIKey | VCMVROMLNFBJFP-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.02 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 177191966 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177191966?
The IUPAC name of CID 177191966 (CID 177191966) is not available.
What is the SMILES notation for CID 177191966?
The canonical SMILES for CID 177191966 is CC(C)N(O)c1ccccc1[B]O.
What is the InChIKey of CID 177191966?
The InChIKey is VCMVROMLNFBJFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BNO2/c1-7(2)11(13)9-6-4-3-5-8(9)10-12/h3-7,12-13H,1-2H3.
What are the key properties of CID 177191966?
CID 177191966 has a molecular weight of 178.02 g/mol, XLogP of 0.53, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177191966 is sourced from PubChem (CID 177191966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).