C24H27N — CID 164746204
2,4-diphenyl-N,N-di(propan-2-yl)aniline (PubChem CID 164746204) has the molecular formula C24H27N and a molecular weight of 329.49 g/mol. Its IUPAC name is 2,4-diphenyl-N,N-di(propan-2-yl)aniline.
| Compound Name | 2,4-diphenyl-N,N-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 164746204 |
| Molecular Formula | C24H27N |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 2,4-diphenyl-N,N-di(propan-2-yl)aniline |
| SMILES | CC(C)N(c1ccc(-c2ccccc2)cc1-c1ccccc1)C(C)C |
| InChI | InChI=1S/C24H27N/c1-18(2)25(19(3)4)24-16-15-22(20-11-7-5-8-12-20)17-23(24)21-13-9-6-10-14-21/h5-19H,1-4H3 |
| InChIKey | LEPLNINJARKGIM-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |