C51H62CuN3P — CID 140754411
bis[2-[di(propan-2-yl)amino]phenyl]-propan-2-ylphosphanium;copper;(2,4,6-triphenylphenyl)azanide (PubChem CID 140754411) has the molecular formula C51H62CuN3P and a molecular weight of 811.60 g/mol. Its IUPAC name is bis[2-[di(propan-2-yl)amino]phenyl]-propan-2-ylphosphanium;copper;(2,4,6-triphenylphenyl)azanide.
| Compound Name | bis[2-[di(propan-2-yl)amino]phenyl]-propan-2-ylphosphanium;copper;(2,4,6-triphenylphenyl)azanide |
|---|---|
| PubChem CID | 140754411 |
| Molecular Formula | C51H62CuN3P |
| Molecular Weight | 811.60 g/mol |
| Exact Mass | 810.40 |
| IUPAC Name | bis[2-[di(propan-2-yl)amino]phenyl]-propan-2-ylphosphanium;copper;(2,4,6-triphenylphenyl)azanide |
| SMILES | CC(C)N(c1ccccc1[PH+](c1ccccc1N(C(C)C)C(C)C)C(C)C)C(C)C.[Cu].[NH-]c1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C27H43N2P.C24H18N.Cu/c1-19(2)28(20(3)4)24-15-11-13-17-26(24)30(23(9)10)27-18-14-12-16-25(27)29(21(5)6)22(7)8;25-24-22(19-12-6-2-7-13-19)16-21(18-10-4-1-5-11-18)17-23(24)20-14-8-3-9-15-20;/h11-23H,1-10H3;1-17,25H;/q;-1;/p+1 |
| InChIKey | PZHSEBGLQRCWKR-UHFFFAOYSA-O |
| XLogP | 13.88 |
| TPSA | 30.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.60 |
| LogP ≤ 5 | 13.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|