C11H9Cl3O — CID 11021731
trans-(1R,3S)-2,2-dichloro-1-methyl-3-phenylcyclopropane-1-carbonyl chloride (PubChem CID 11021731) has the molecular formula C11H9Cl3O and a molecular weight of 263.55 g/mol. Its IUPAC name is trans-(1R,3S)-2,2-dichloro-1-methyl-3-phenylcyclopropane-1-carbonyl chloride.
| Compound Name | trans-(1R,3S)-2,2-dichloro-1-methyl-3-phenylcyclopropane-1-carbonyl chloride |
|---|---|
| PubChem CID | 11021731 |
| Molecular Formula | C11H9Cl3O |
| Molecular Weight | 263.55 g/mol |
| Exact Mass | 261.97 |
| IUPAC Name | trans-(1R,3S)-2,2-dichloro-1-methyl-3-phenylcyclopropane-1-carbonyl chloride |
| SMILES | C[C@]1(C(=O)Cl)[C@H](c2ccccc2)C1(Cl)Cl |
| InChI | InChI=1S/C11H9Cl3O/c1-10(9(12)15)8(11(10,13)14)7-5-3-2-4-6-7/h2-6,8H,1H3/t8-,10+/m0/s1 |
| InChIKey | VKHVRDNQGVHTPE-WCBMZHEXSA-N |
| XLogP | 3.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|