C11H9Br2ClO — CID 11100269
2,2-dibromo-1-methyl-3-phenylcyclopropane-1-carbonyl chloride (PubChem CID 11100269) has the molecular formula C11H9Br2ClO and a molecular weight of 352.45 g/mol. Its IUPAC name is 2,2-dibromo-1-methyl-3-phenylcyclopropane-1-carbonyl chloride.
| Compound Name | 2,2-dibromo-1-methyl-3-phenylcyclopropane-1-carbonyl chloride |
|---|---|
| PubChem CID | 11100269 |
| Molecular Formula | C11H9Br2ClO |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 349.87 |
| IUPAC Name | 2,2-dibromo-1-methyl-3-phenylcyclopropane-1-carbonyl chloride |
| SMILES | CC1(C(=O)Cl)C(c2ccccc2)C1(Br)Br |
| InChI | InChI=1S/C11H9Br2ClO/c1-10(9(14)15)8(11(10,12)13)7-5-3-2-4-6-7/h2-6,8H,1H3 |
| InChIKey | XQJWCYHBVSZNJS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|