2,2-dibromo-1-methyl-3-phenylcyclopropane-1-carbonyl chloride

C11H9Br2ClO — CID 11100269

IUPAC2,2-dibromo-1-methyl-3-phenylcyclopropane-1-carbonyl chloride
SMILESCC1(C(=O)Cl)C(c2ccccc2)C1(Br)Br
InChIInChI=1S/C11H9Br2ClO/c1-10(9(14)15)8(11(10,12)13)7-5-3-2-4-6-7/h2-6,8H,1H3
InChIKeyXQJWCYHBVSZNJS-UHFFFAOYSA-N
MW352.45 g/mol
LogP4.04
Rot. Bonds2

About 2,2-dibromo-1-methyl-3-phenylcyclopropane-1-carbonyl chloride

2,2-dibromo-1-methyl-3-phenylcyclopropane-1-carbonyl chloride (PubChem CID 11100269) has the molecular formula C11H9Br2ClO and a molecular weight of 352.45 g/mol. Its IUPAC name is 2,2-dibromo-1-methyl-3-phenylcyclopropane-1-carbonyl chloride.

Molecular Properties

Compound Name2,2-dibromo-1-methyl-3-phenylcyclopropane-1-carbonyl chloride
PubChem CID11100269
Molecular FormulaC11H9Br2ClO
Molecular Weight352.45 g/mol
Exact Mass349.87
IUPAC Name2,2-dibromo-1-methyl-3-phenylcyclopropane-1-carbonyl chloride
SMILESCC1(C(=O)Cl)C(c2ccccc2)C1(Br)Br
InChIInChI=1S/C11H9Br2ClO/c1-10(9(14)15)8(11(10,12)13)7-5-3-2-4-6-7/h2-6,8H,1H3
InChIKeyXQJWCYHBVSZNJS-UHFFFAOYSA-N
XLogP4.04
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500352.45
LogP ≤ 54.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 2,2-dibromo-1-methyl-3-phenylcyclopropane-1-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dibromo-1-methyl-3-phenylcyclopropane-1-carbonyl chloride?
The IUPAC name of 2,2-dibromo-1-methyl-3-phenylcyclopropane-1-carbonyl chloride (CID 11100269) is 2,2-dibromo-1-methyl-3-phenylcyclopropane-1-carbonyl chloride.
What is the SMILES notation for 2,2-dibromo-1-methyl-3-phenylcyclopropane-1-carbonyl chloride?
The canonical SMILES for 2,2-dibromo-1-methyl-3-phenylcyclopropane-1-carbonyl chloride is CC1(C(=O)Cl)C(c2ccccc2)C1(Br)Br.
What is the InChIKey of 2,2-dibromo-1-methyl-3-phenylcyclopropane-1-carbonyl chloride?
The InChIKey is XQJWCYHBVSZNJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Br2ClO/c1-10(9(14)15)8(11(10,12)13)7-5-3-2-4-6-7/h2-6,8H,1H3.
What are the key properties of 2,2-dibromo-1-methyl-3-phenylcyclopropane-1-carbonyl chloride?
2,2-dibromo-1-methyl-3-phenylcyclopropane-1-carbonyl chloride has a molecular weight of 352.45 g/mol, XLogP of 4.04, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dibromo-1-methyl-3-phenylcyclopropane-1-carbonyl chloride is sourced from PubChem (CID 11100269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).