C17H14N3O2S- — CID 7361115
2-[[(5R)-5,6-diphenyl-2,5-dihydro-1,2,4-triazin-3-yl]sulfanyl]acetate (PubChem CID 7361115) has the molecular formula C17H14N3O2S- and a molecular weight of 324.39 g/mol. Its IUPAC name is 2-[[(5R)-5,6-diphenyl-2,5-dihydro-1,2,4-triazin-3-yl]sulfanyl]acetate.
| Compound Name | 2-[[(5R)-5,6-diphenyl-2,5-dihydro-1,2,4-triazin-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 7361115 |
| Molecular Formula | C17H14N3O2S- |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 2-[[(5R)-5,6-diphenyl-2,5-dihydro-1,2,4-triazin-3-yl]sulfanyl]acetate |
| SMILES | O=C([O-])CSC1=N[C@H](c2ccccc2)C(c2ccccc2)=NN1 |
| InChI | InChI=1S/C17H15N3O2S/c21-14(22)11-23-17-18-15(12-7-3-1-4-8-12)16(19-20-17)13-9-5-2-6-10-13/h1-10,15H,11H2,(H,18,20)(H,21,22)/p-1/t15-/m1/s1 |
| InChIKey | KAKAKJXNLSXLNR-OAHLLOKOSA-M |
| XLogP | 1.57 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |