C23H19N3O — CID 102438897
1-(3,5,6-triphenyl-5H-1,2,4-triazin-2-yl)ethanone (PubChem CID 102438897) has the molecular formula C23H19N3O and a molecular weight of 353.43 g/mol. Its IUPAC name is 1-(3,5,6-triphenyl-5H-1,2,4-triazin-2-yl)ethanone.
| Compound Name | 1-(3,5,6-triphenyl-5H-1,2,4-triazin-2-yl)ethanone |
|---|---|
| PubChem CID | 102438897 |
| Molecular Formula | C23H19N3O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 1-(3,5,6-triphenyl-5H-1,2,4-triazin-2-yl)ethanone |
| SMILES | CC(=O)N1N=C(c2ccccc2)C(c2ccccc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C23H19N3O/c1-17(27)26-23(20-15-9-4-10-16-20)24-21(18-11-5-2-6-12-18)22(25-26)19-13-7-3-8-14-19/h2-16,21H,1H3 |
| InChIKey | FTFTYIULWSCFNU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |