C37H28Cl2N6OS — CID 10009717
2,4-dichloro-N-[2-[(E)-3-[2-(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinyl]-1-phenylprop-2-enyl]sulfanylphenyl]benzamide (PubChem CID 10009717) has the molecular formula C37H28Cl2N6OS and a molecular weight of 675.65 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[(E)-3-[2-(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinyl]-1-phenylprop-2-enyl]sulfanylphenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[(E)-3-[2-(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinyl]-1-phenylprop-2-enyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 10009717 |
| Molecular Formula | C37H28Cl2N6OS |
| Molecular Weight | 675.65 g/mol |
| Exact Mass | 674.14 |
| IUPAC Name | 2,4-dichloro-N-[2-[(E)-3-[2-(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinyl]-1-phenylprop-2-enyl]sulfanylphenyl]benzamide |
| SMILES | O=C(Nc1ccccc1SC(/C=C/NNc1nnc(-c2ccccc2)c(-c2ccccc2)n1)c1ccccc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C37H28Cl2N6OS/c38-28-20-21-29(30(39)24-28)36(46)41-31-18-10-11-19-33(31)47-32(25-12-4-1-5-13-25)22-23-40-44-37-42-34(26-14-6-2-7-15-26)35(43-45-37)27-16-8-3-9-17-27/h1-24,32,40H,(H,41,46)(H,42,44,45)/b23-22+ |
| InChIKey | LQCPUUKKBCSMPS-GHVJWSGMSA-N |
| XLogP | 9.73 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.65 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|