C37H30Cl2N6OS — CID 96582554
2,4-dichloro-N-[2-[(E,1S)-3-[2-[(5S)-5,6-diphenyl-2,5-dihydro-1,2,4-triazin-3-yl]hydrazinyl]-1-phenylprop-2-enyl]sulfanylphenyl]benzamide (PubChem CID 96582554) has the molecular formula C37H30Cl2N6OS and a molecular weight of 677.66 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[(E,1S)-3-[2-[(5S)-5,6-diphenyl-2,5-dihydro-1,2,4-triazin-3-yl]hydrazinyl]-1-phenylprop-2-enyl]sulfanylphenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[(E,1S)-3-[2-[(5S)-5,6-diphenyl-2,5-dihydro-1,2,4-triazin-3-yl]hydrazinyl]-1-phenylprop-2-enyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 96582554 |
| Molecular Formula | C37H30Cl2N6OS |
| Molecular Weight | 677.66 g/mol |
| Exact Mass | 676.16 |
| IUPAC Name | 2,4-dichloro-N-[2-[(E,1S)-3-[2-[(5S)-5,6-diphenyl-2,5-dihydro-1,2,4-triazin-3-yl]hydrazinyl]-1-phenylprop-2-enyl]sulfanylphenyl]benzamide |
| SMILES | O=C(Nc1ccccc1S[C@@H](/C=C/NNC1=N[C@@H](c2ccccc2)C(c2ccccc2)=NN1)c1ccccc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C37H30Cl2N6OS/c38-28-20-21-29(30(39)24-28)36(46)41-31-18-10-11-19-33(31)47-32(25-12-4-1-5-13-25)22-23-40-44-37-42-34(26-14-6-2-7-15-26)35(43-45-37)27-16-8-3-9-17-27/h1-24,32,34,40H,(H,41,46)(H2,42,44,45)/b23-22+/t32-,34-/m0/s1 |
| InChIKey | DMLOPYUIVRRXDB-VGYXIBMHSA-N |
| XLogP | 8.79 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.66 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|