C5H5BrFN — CID 123887504
6-bromo-3-fluoro-2,3-dihydropyridine (PubChem CID 123887504) has the molecular formula C5H5BrFN and a molecular weight of 178.00 g/mol. Its IUPAC name is 6-bromo-3-fluoro-2,3-dihydropyridine.
| Compound Name | 6-bromo-3-fluoro-2,3-dihydropyridine |
|---|---|
| PubChem CID | 123887504 |
| Molecular Formula | C5H5BrFN |
| Molecular Weight | 178.00 g/mol |
| Exact Mass | 176.96 |
| IUPAC Name | 6-bromo-3-fluoro-2,3-dihydropyridine |
| SMILES | FC1C=CC(Br)=NC1 |
| InChI | InChI=1S/C5H5BrFN/c6-5-2-1-4(7)3-8-5/h1-2,4H,3H2 |
| InChIKey | KOEMWSZSECZYFU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.00 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |