C5H5BrFN — CID 163729763
5-bromo-2-fluoro-2,3-dihydropyridine (PubChem CID 163729763) has the molecular formula C5H5BrFN and a molecular weight of 178.00 g/mol. Its IUPAC name is 5-bromo-2-fluoro-2,3-dihydropyridine.
| Compound Name | 5-bromo-2-fluoro-2,3-dihydropyridine |
|---|---|
| PubChem CID | 163729763 |
| Molecular Formula | C5H5BrFN |
| Molecular Weight | 178.00 g/mol |
| Exact Mass | 176.96 |
| IUPAC Name | 5-bromo-2-fluoro-2,3-dihydropyridine |
| SMILES | FC1CC=C(Br)C=N1 |
| InChI | InChI=1S/C5H5BrFN/c6-4-1-2-5(7)8-3-4/h1,3,5H,2H2 |
| InChIKey | KYPOBLBGPRNHMC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.00 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|