C13H12Cl2N6O3 — CID 123887521
1-[6-[4-(carbamoylamino)-2,3-dichlorophenoxy]pyrimidin-4-yl]-3-methylurea (PubChem CID 123887521) has the molecular formula C13H12Cl2N6O3 and a molecular weight of 371.18 g/mol. Its IUPAC name is 1-[6-[4-(carbamoylamino)-2,3-dichlorophenoxy]pyrimidin-4-yl]-3-methylurea.
| Compound Name | 1-[6-[4-(carbamoylamino)-2,3-dichlorophenoxy]pyrimidin-4-yl]-3-methylurea |
|---|---|
| PubChem CID | 123887521 |
| Molecular Formula | C13H12Cl2N6O3 |
| Molecular Weight | 371.18 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 1-[6-[4-(carbamoylamino)-2,3-dichlorophenoxy]pyrimidin-4-yl]-3-methylurea |
| SMILES | CNC(=O)Nc1cc(Oc2ccc(NC(N)=O)c(Cl)c2Cl)ncn1 |
| InChI | InChI=1S/C13H12Cl2N6O3/c1-17-13(23)21-8-4-9(19-5-18-8)24-7-3-2-6(20-12(16)22)10(14)11(7)15/h2-5H,1H3,(H3,16,20,22)(H2,17,18,19,21,23) |
| InChIKey | ZAECKRHVNCEWDN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.18 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |