C16H19F3N2O5 — CID 123888731
2-[[4-methyl-2-[[4-(trifluoromethyl)phenyl]carbamoyloxy]pentanoyl]amino]acetic acid (PubChem CID 123888731) has the molecular formula C16H19F3N2O5 and a molecular weight of 376.33 g/mol. Its IUPAC name is 2-[[4-methyl-2-[[4-(trifluoromethyl)phenyl]carbamoyloxy]pentanoyl]amino]acetic acid.
| Compound Name | 2-[[4-methyl-2-[[4-(trifluoromethyl)phenyl]carbamoyloxy]pentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 123888731 |
| Molecular Formula | C16H19F3N2O5 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-[[4-methyl-2-[[4-(trifluoromethyl)phenyl]carbamoyloxy]pentanoyl]amino]acetic acid |
| SMILES | CC(C)CC(OC(=O)Nc1ccc(C(F)(F)F)cc1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C16H19F3N2O5/c1-9(2)7-12(14(24)20-8-13(22)23)26-15(25)21-11-5-3-10(4-6-11)16(17,18)19/h3-6,9,12H,7-8H2,1-2H3,(H,20,24)(H,21,25)(H,22,23) |
| InChIKey | GYBQQXUCXPLSHJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |