C13H21N5O — CID 123889262
N-(2-morpholin-4-ylethyl)-5-[(3E)-penta-1,3-dien-3-yl]-1H-1,2,4-triazol-3-amine (PubChem CID 123889262) has the molecular formula C13H21N5O and a molecular weight of 263.34 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-5-[(3E)-penta-1,3-dien-3-yl]-1H-1,2,4-triazol-3-amine.
| Compound Name | N-(2-morpholin-4-ylethyl)-5-[(3E)-penta-1,3-dien-3-yl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 123889262 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-5-[(3E)-penta-1,3-dien-3-yl]-1H-1,2,4-triazol-3-amine |
| SMILES | C=C/C(=C\C)c1nc(NCCN2CCOCC2)n[nH]1 |
| InChI | InChI=1S/C13H21N5O/c1-3-11(4-2)12-15-13(17-16-12)14-5-6-18-7-9-19-10-8-18/h3-4H,1,5-10H2,2H3,(H2,14,15,16,17)/b11-4+ |
| InChIKey | FHNZAMYHHWJFRJ-NYYWCZLTSA-N |
| XLogP | 1.14 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|