C24H21N7O3 — CID 123889651
11-[(6-amino-2,3-dihydro-1,4-benzodioxin-2-yl)methyl-methylamino]-8-phenyl-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-7-one (PubChem CID 123889651) has the molecular formula C24H21N7O3 and a molecular weight of 455.48 g/mol. Its IUPAC name is 11-[(6-amino-2,3-dihydro-1,4-benzodioxin-2-yl)methyl-methylamino]-8-phenyl-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-7-one.
| Compound Name | 11-[(6-amino-2,3-dihydro-1,4-benzodioxin-2-yl)methyl-methylamino]-8-phenyl-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-7-one |
|---|---|
| PubChem CID | 123889651 |
| Molecular Formula | C24H21N7O3 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 11-[(6-amino-2,3-dihydro-1,4-benzodioxin-2-yl)methyl-methylamino]-8-phenyl-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-7-one |
| SMILES | CN(CC1COc2cc(N)ccc2O1)c1ncc2c3[nH]ncc3c(=O)n(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C24H21N7O3/c1-30(12-16-13-33-20-9-14(25)7-8-19(20)34-16)24-26-10-17-21-18(11-27-29-21)23(32)31(22(17)28-24)15-5-3-2-4-6-15/h2-11,16H,12-13,25H2,1H3,(H,27,29) |
| InChIKey | ORKULRINFUQVDW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|