C27H37N2O4S+ — CID 123890004
ethane;N-[2-(1-methoxy-3-methylpyridin-1-ium-2-carbonyl)-4,5-dimethylphenyl]-4-methylbenzenesulfonamide (PubChem CID 123890004) has the molecular formula C27H37N2O4S+ and a molecular weight of 485.67 g/mol. Its IUPAC name is ethane;N-[2-(1-methoxy-3-methylpyridin-1-ium-2-carbonyl)-4,5-dimethylphenyl]-4-methylbenzenesulfonamide.
| Compound Name | ethane;N-[2-(1-methoxy-3-methylpyridin-1-ium-2-carbonyl)-4,5-dimethylphenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 123890004 |
| Molecular Formula | C27H37N2O4S+ |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | ethane;N-[2-(1-methoxy-3-methylpyridin-1-ium-2-carbonyl)-4,5-dimethylphenyl]-4-methylbenzenesulfonamide |
| SMILES | CC.CC.CO[n+]1cccc(C)c1C(=O)c1cc(C)c(C)cc1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H24N2O4S.2C2H6/c1-15-8-10-19(11-9-15)30(27,28)24-21-14-18(4)17(3)13-20(21)23(26)22-16(2)7-6-12-25(22)29-5;2*1-2/h6-14H,1-5H3;2*1-2H3/p+1 |
| InChIKey | WDEOORKMOHZWCP-UHFFFAOYSA-O |
| XLogP | 5.35 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|