C16H21NO — CID 123890229
N-benzyl-2-methoxy-N-prop-2-enylpenta-1,3-dien-3-amine (PubChem CID 123890229) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is N-benzyl-2-methoxy-N-prop-2-enylpenta-1,3-dien-3-amine.
| Compound Name | N-benzyl-2-methoxy-N-prop-2-enylpenta-1,3-dien-3-amine |
|---|---|
| PubChem CID | 123890229 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | N-benzyl-2-methoxy-N-prop-2-enylpenta-1,3-dien-3-amine |
| SMILES | C=CCN(Cc1ccccc1)C(=CC)C(=C)OC |
| InChI | InChI=1S/C16H21NO/c1-5-12-17(16(6-2)14(3)18-4)13-15-10-8-7-9-11-15/h5-11H,1,3,12-13H2,2,4H3 |
| InChIKey | AKXXBBKVZQBZSU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|